C14H22BrClN2O3S — CID 119508899
2-(4-bromophenyl)sulfonyl-N-[2-(ethylamino)ethyl]-2-methylpropanamide;hydrochloride (PubChem CID 119508899) has the molecular formula C14H22BrClN2O3S and a molecular weight of 413.77 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfonyl-N-[2-(ethylamino)ethyl]-2-methylpropanamide;hydrochloride.
| Compound Name | 2-(4-bromophenyl)sulfonyl-N-[2-(ethylamino)ethyl]-2-methylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119508899 |
| Molecular Formula | C14H22BrClN2O3S |
| Molecular Weight | 413.77 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | 2-(4-bromophenyl)sulfonyl-N-[2-(ethylamino)ethyl]-2-methylpropanamide;hydrochloride |
| SMILES | CCNCCNC(=O)C(C)(C)S(=O)(=O)c1ccc(Br)cc1.Cl |
| InChI | InChI=1S/C14H21BrN2O3S.ClH/c1-4-16-9-10-17-13(18)14(2,3)21(19,20)12-7-5-11(15)6-8-12;/h5-8,16H,4,9-10H2,1-3H3,(H,17,18);1H |
| InChIKey | RVIGMROMFZZJEF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.77 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|