C18H25FN2O3 — CID 11952279
methyl N-(4-fluorophenyl)-N-[1-(oxan-4-yl)piperidin-4-yl]carbamate (PubChem CID 11952279) has the molecular formula C18H25FN2O3 and a molecular weight of 336.41 g/mol. Its IUPAC name is methyl N-(4-fluorophenyl)-N-[1-(oxan-4-yl)piperidin-4-yl]carbamate.
| Compound Name | methyl N-(4-fluorophenyl)-N-[1-(oxan-4-yl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 11952279 |
| Molecular Formula | C18H25FN2O3 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | methyl N-(4-fluorophenyl)-N-[1-(oxan-4-yl)piperidin-4-yl]carbamate |
| SMILES | COC(=O)N(c1ccc(F)cc1)C1CCN(C2CCOCC2)CC1 |
| InChI | InChI=1S/C18H25FN2O3/c1-23-18(22)21(16-4-2-14(19)3-5-16)17-6-10-20(11-7-17)15-8-12-24-13-9-15/h2-5,15,17H,6-13H2,1H3 |
| InChIKey | HAJPGCOENIWTHA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |