C20H30FN3O2 — CID 72875264
2-(dimethylamino)-2-(4-fluorophenyl)-N-[1-(oxan-4-yl)piperidin-4-yl]acetamide (PubChem CID 72875264) has the molecular formula C20H30FN3O2 and a molecular weight of 363.48 g/mol. Its IUPAC name is 2-(dimethylamino)-2-(4-fluorophenyl)-N-[1-(oxan-4-yl)piperidin-4-yl]acetamide.
| Compound Name | 2-(dimethylamino)-2-(4-fluorophenyl)-N-[1-(oxan-4-yl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 72875264 |
| Molecular Formula | C20H30FN3O2 |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 2-(dimethylamino)-2-(4-fluorophenyl)-N-[1-(oxan-4-yl)piperidin-4-yl]acetamide |
| SMILES | CN(C)C(C(=O)NC1CCN(C2CCOCC2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H30FN3O2/c1-23(2)19(15-3-5-16(21)6-4-15)20(25)22-17-7-11-24(12-8-17)18-9-13-26-14-10-18/h3-6,17-19H,7-14H2,1-2H3,(H,22,25) |
| InChIKey | JRXJBDWLTHIXEQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |