C14H17ClN4O3S — CID 119523625
N-(1-amino-2-methylpropan-2-yl)-2-(4-nitrophenyl)-1,3-thiazole-4-carboxamide;hydrochloride (PubChem CID 119523625) has the molecular formula C14H17ClN4O3S and a molecular weight of 356.84 g/mol. Its IUPAC name is N-(1-amino-2-methylpropan-2-yl)-2-(4-nitrophenyl)-1,3-thiazole-4-carboxamide;hydrochloride.
| Compound Name | N-(1-amino-2-methylpropan-2-yl)-2-(4-nitrophenyl)-1,3-thiazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119523625 |
| Molecular Formula | C14H17ClN4O3S |
| Molecular Weight | 356.84 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | N-(1-amino-2-methylpropan-2-yl)-2-(4-nitrophenyl)-1,3-thiazole-4-carboxamide;hydrochloride |
| SMILES | CC(C)(CN)NC(=O)c1csc(-c2ccc([N+](=O)[O-])cc2)n1.Cl |
| InChI | InChI=1S/C14H16N4O3S.ClH/c1-14(2,8-15)17-12(19)11-7-22-13(16-11)9-3-5-10(6-4-9)18(20)21;/h3-7H,8,15H2,1-2H3,(H,17,19);1H |
| InChIKey | AQBPAFVFRSFGKV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.84 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|