C30H35FN4O4 — CID 11952692
N-[1-[[3-[4-[[2-[(4-fluorophenyl)methoxy]acetyl]amino]butoxy]phenyl]methyl]pyrrolidin-3-yl]pyridine-4-carboxamide (PubChem CID 11952692) has the molecular formula C30H35FN4O4 and a molecular weight of 534.63 g/mol. Its IUPAC name is N-[1-[[3-[4-[[2-[(4-fluorophenyl)methoxy]acetyl]amino]butoxy]phenyl]methyl]pyrrolidin-3-yl]pyridine-4-carboxamide.
| Compound Name | N-[1-[[3-[4-[[2-[(4-fluorophenyl)methoxy]acetyl]amino]butoxy]phenyl]methyl]pyrrolidin-3-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 11952692 |
| Molecular Formula | C30H35FN4O4 |
| Molecular Weight | 534.63 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | N-[1-[[3-[4-[[2-[(4-fluorophenyl)methoxy]acetyl]amino]butoxy]phenyl]methyl]pyrrolidin-3-yl]pyridine-4-carboxamide |
| SMILES | O=C(COCc1ccc(F)cc1)NCCCCOc1cccc(CN2CCC(NC(=O)c3ccncc3)C2)c1 |
| InChI | InChI=1S/C30H35FN4O4/c31-26-8-6-23(7-9-26)21-38-22-29(36)33-13-1-2-17-39-28-5-3-4-24(18-28)19-35-16-12-27(20-35)34-30(37)25-10-14-32-15-11-25/h3-11,14-15,18,27H,1-2,12-13,16-17,19-22H2,(H,33,36)(H,34,37) |
| InChIKey | MTRPDXRZVRMNAL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.63 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|