C15H20ClN3O4S — CID 119549161
N-[2-(4-aminophenyl)ethyl]-5-(methanesulfonamidomethyl)furan-2-carboxamide;hydrochloride (PubChem CID 119549161) has the molecular formula C15H20ClN3O4S and a molecular weight of 373.86 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-5-(methanesulfonamidomethyl)furan-2-carboxamide;hydrochloride.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-5-(methanesulfonamidomethyl)furan-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119549161 |
| Molecular Formula | C15H20ClN3O4S |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-5-(methanesulfonamidomethyl)furan-2-carboxamide;hydrochloride |
| SMILES | CS(=O)(=O)NCc1ccc(C(=O)NCCc2ccc(N)cc2)o1.Cl |
| InChI | InChI=1S/C15H19N3O4S.ClH/c1-23(20,21)18-10-13-6-7-14(22-13)15(19)17-9-8-11-2-4-12(16)5-3-11;/h2-7,18H,8-10,16H2,1H3,(H,17,19);1H |
| InChIKey | SFNNLYQIQZTXCM-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 114.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|