C28H25F5N2O3 — CID 11955402
N-[1-(2-fluoro-4-pyridinyl)-1-hydroxy-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-2-yl]-8,9-dihydro-7H-benzo[7]annulene-4-carboxamide (PubChem CID 11955402) has the molecular formula C28H25F5N2O3 and a molecular weight of 532.51 g/mol. Its IUPAC name is N-[1-(2-fluoro-4-pyridinyl)-1-hydroxy-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-2-yl]-8,9-dihydro-7H-benzo[7]annulene-4-carboxamide.
| Compound Name | N-[1-(2-fluoro-4-pyridinyl)-1-hydroxy-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-2-yl]-8,9-dihydro-7H-benzo[7]annulene-4-carboxamide |
|---|---|
| PubChem CID | 11955402 |
| Molecular Formula | C28H25F5N2O3 |
| Molecular Weight | 532.51 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | N-[1-(2-fluoro-4-pyridinyl)-1-hydroxy-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-2-yl]-8,9-dihydro-7H-benzo[7]annulene-4-carboxamide |
| SMILES | O=C(NC(Cc1cccc(OC(F)(F)C(F)F)c1)C(O)c1ccnc(F)c1)c1cccc2c1C=CCCC2 |
| InChI | InChI=1S/C28H25F5N2O3/c29-24-16-19(12-13-34-24)25(36)23(15-17-6-4-9-20(14-17)38-28(32,33)27(30)31)35-26(37)22-11-5-8-18-7-2-1-3-10-21(18)22/h3-6,8-14,16,23,25,27,36H,1-2,7,15H2,(H,35,37) |
| InChIKey | ZXLFCMYJYAIUJH-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.51 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|