C23H20F4N2O5 — CID 22261831
[1-hydroxy-1-(4-pyridin-3-yloxyphenyl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-2-yl]carbamic acid (PubChem CID 22261831) has the molecular formula C23H20F4N2O5 and a molecular weight of 480.41 g/mol. Its IUPAC name is [1-hydroxy-1-(4-pyridin-3-yloxyphenyl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-2-yl]carbamic acid.
| Compound Name | [1-hydroxy-1-(4-pyridin-3-yloxyphenyl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 22261831 |
| Molecular Formula | C23H20F4N2O5 |
| Molecular Weight | 480.41 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | [1-hydroxy-1-(4-pyridin-3-yloxyphenyl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-2-yl]carbamic acid |
| SMILES | O=C(O)NC(Cc1cccc(OC(F)(F)C(F)F)c1)C(O)c1ccc(Oc2cccnc2)cc1 |
| InChI | InChI=1S/C23H20F4N2O5/c24-21(25)23(26,27)34-17-4-1-3-14(11-17)12-19(29-22(31)32)20(30)15-6-8-16(9-7-15)33-18-5-2-10-28-13-18/h1-11,13,19-21,29-30H,12H2,(H,31,32) |
| InChIKey | IMWLJKAZVIMYNL-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.41 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|