C26H22ClF4O5- — CID 22261550
3-[4-(4-chloro-3-ethylphenoxy)phenyl]-3-hydroxy-2-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]propanoate (PubChem CID 22261550) has the molecular formula C26H22ClF4O5- and a molecular weight of 525.90 g/mol. Its IUPAC name is 3-[4-(4-chloro-3-ethylphenoxy)phenyl]-3-hydroxy-2-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]propanoate.
| Compound Name | 3-[4-(4-chloro-3-ethylphenoxy)phenyl]-3-hydroxy-2-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]propanoate |
|---|---|
| PubChem CID | 22261550 |
| Molecular Formula | C26H22ClF4O5- |
| Molecular Weight | 525.90 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | 3-[4-(4-chloro-3-ethylphenoxy)phenyl]-3-hydroxy-2-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]propanoate |
| SMILES | CCc1cc(Oc2ccc(C(O)C(Cc3cccc(OC(F)(F)C(F)F)c3)C(=O)[O-])cc2)ccc1Cl |
| InChI | InChI=1S/C26H23ClF4O5/c1-2-16-14-19(10-11-22(16)27)35-18-8-6-17(7-9-18)23(32)21(24(33)34)13-15-4-3-5-20(12-15)36-26(30,31)25(28)29/h3-12,14,21,23,25,32H,2,13H2,1H3,(H,33,34)/p-1 |
| InChIKey | PHQKFOLUAAEUHG-UHFFFAOYSA-M |
| XLogP | 5.57 |
| TPSA | 78.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.90 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|