C23H25ClF7NO3 — CID 10208763
3-[3-(4-chloro-3-ethylphenoxy)propyl-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]amino]-1,1,1-trifluoropropan-2-ol (PubChem CID 10208763) has the molecular formula C23H25ClF7NO3 and a molecular weight of 531.90 g/mol. Its IUPAC name is 3-[3-(4-chloro-3-ethylphenoxy)propyl-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]amino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[3-(4-chloro-3-ethylphenoxy)propyl-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]amino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 10208763 |
| Molecular Formula | C23H25ClF7NO3 |
| Molecular Weight | 531.90 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | 3-[3-(4-chloro-3-ethylphenoxy)propyl-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]amino]-1,1,1-trifluoropropan-2-ol |
| SMILES | CCc1cc(OCCCN(Cc2cccc(OC(F)(F)C(F)F)c2)CC(O)C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C23H25ClF7NO3/c1-2-16-12-17(7-8-19(16)24)34-10-4-9-32(14-20(33)22(27,28)29)13-15-5-3-6-18(11-15)35-23(30,31)21(25)26/h3,5-8,11-12,20-21,33H,2,4,9-10,13-14H2,1H3 |
| InChIKey | IELXUOOARVGPDV-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.90 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|