C26H23ClF7NO3 — CID 131723484
3-[2-(4-chloro-3-ethylphenoxy)phenyl]-1,1,1-trifluoro-2-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methylamino]propan-2-ol (PubChem CID 131723484) has the molecular formula C26H23ClF7NO3 and a molecular weight of 565.91 g/mol. Its IUPAC name is 3-[2-(4-chloro-3-ethylphenoxy)phenyl]-1,1,1-trifluoro-2-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methylamino]propan-2-ol.
| Compound Name | 3-[2-(4-chloro-3-ethylphenoxy)phenyl]-1,1,1-trifluoro-2-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methylamino]propan-2-ol |
|---|---|
| PubChem CID | 131723484 |
| Molecular Formula | C26H23ClF7NO3 |
| Molecular Weight | 565.91 g/mol |
| Exact Mass | 565.13 |
| IUPAC Name | 3-[2-(4-chloro-3-ethylphenoxy)phenyl]-1,1,1-trifluoro-2-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methylamino]propan-2-ol |
| SMILES | CCc1cc(Oc2ccccc2CC(O)(NCc2cccc(OC(F)(F)C(F)F)c2)C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C26H23ClF7NO3/c1-2-17-13-19(10-11-21(17)27)37-22-9-4-3-7-18(22)14-24(36,26(32,33)34)35-15-16-6-5-8-20(12-16)38-25(30,31)23(28)29/h3-13,23,35-36H,2,14-15H2,1H3 |
| InChIKey | VSEFKHNMTMKZSO-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.91 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|