C26H22ClF8NO2 — CID 158061886
3-[3-(4-chloro-3-ethylphenoxy)phenyl]-1,1,1-trifluoro-2-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methylamino]propan-2-ol (PubChem CID 158061886) has the molecular formula C26H22ClF8NO2 and a molecular weight of 567.90 g/mol. Its IUPAC name is 3-[3-(4-chloro-3-ethylphenoxy)phenyl]-1,1,1-trifluoro-2-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methylamino]propan-2-ol.
| Compound Name | 3-[3-(4-chloro-3-ethylphenoxy)phenyl]-1,1,1-trifluoro-2-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methylamino]propan-2-ol |
|---|---|
| PubChem CID | 158061886 |
| Molecular Formula | C26H22ClF8NO2 |
| Molecular Weight | 567.90 g/mol |
| Exact Mass | 567.12 |
| IUPAC Name | 3-[3-(4-chloro-3-ethylphenoxy)phenyl]-1,1,1-trifluoro-2-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methylamino]propan-2-ol |
| SMILES | CCc1cc(Oc2cccc(CC(O)(NCc3cccc(C(F)(F)C(F)(F)F)c3)C(F)(F)F)c2)ccc1Cl |
| InChI | InChI=1S/C26H22ClF8NO2/c1-2-18-13-21(9-10-22(18)27)38-20-8-4-5-16(12-20)14-23(37,25(30,31)32)36-15-17-6-3-7-19(11-17)24(28,29)26(33,34)35/h3-13,36-37H,2,14-15H2,1H3 |
| InChIKey | FKTDRABSSUYFAR-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.90 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|