C26H25F7N2O3 — CID 142665640
3-[3-[3-(dimethylamino)phenoxy]phenyl]-1,1,1-trifluoro-2-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methylamino]propan-2-ol (PubChem CID 142665640) has the molecular formula C26H25F7N2O3 and a molecular weight of 546.48 g/mol. Its IUPAC name is 3-[3-[3-(dimethylamino)phenoxy]phenyl]-1,1,1-trifluoro-2-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methylamino]propan-2-ol.
| Compound Name | 3-[3-[3-(dimethylamino)phenoxy]phenyl]-1,1,1-trifluoro-2-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methylamino]propan-2-ol |
|---|---|
| PubChem CID | 142665640 |
| Molecular Formula | C26H25F7N2O3 |
| Molecular Weight | 546.48 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | 3-[3-[3-(dimethylamino)phenoxy]phenyl]-1,1,1-trifluoro-2-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methylamino]propan-2-ol |
| SMILES | CN(C)c1cccc(Oc2cccc(CC(O)(NCc3cccc(OC(F)(F)C(F)F)c3)C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C26H25F7N2O3/c1-35(2)19-8-5-10-21(14-19)37-20-9-3-6-17(12-20)15-24(36,26(31,32)33)34-16-18-7-4-11-22(13-18)38-25(29,30)23(27)28/h3-14,23,34,36H,15-16H2,1-2H3 |
| InChIKey | CUMFAHMONPMDQM-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.48 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|