C19H19F4NO4 — CID 22261714
methyl 4-[2-amino-1-hydroxy-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]propyl]benzoate (PubChem CID 22261714) has the molecular formula C19H19F4NO4 and a molecular weight of 401.36 g/mol. Its IUPAC name is methyl 4-[2-amino-1-hydroxy-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]propyl]benzoate.
| Compound Name | methyl 4-[2-amino-1-hydroxy-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]propyl]benzoate |
|---|---|
| PubChem CID | 22261714 |
| Molecular Formula | C19H19F4NO4 |
| Molecular Weight | 401.36 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | methyl 4-[2-amino-1-hydroxy-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]propyl]benzoate |
| SMILES | COC(=O)c1ccc(C(O)C(N)Cc2cccc(OC(F)(F)C(F)F)c2)cc1 |
| InChI | InChI=1S/C19H19F4NO4/c1-27-17(26)13-7-5-12(6-8-13)16(25)15(24)10-11-3-2-4-14(9-11)28-19(22,23)18(20)21/h2-9,15-16,18,25H,10,24H2,1H3 |
| InChIKey | QJZHDBPKHKKCIA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|