C19H16F5NO4 — CID 22261762
ethyl 3-(2-fluoro-4-pyridinyl)-3-oxo-2-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]propanoate (PubChem CID 22261762) has the molecular formula C19H16F5NO4 and a molecular weight of 417.33 g/mol. Its IUPAC name is ethyl 3-(2-fluoro-4-pyridinyl)-3-oxo-2-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]propanoate.
| Compound Name | ethyl 3-(2-fluoro-4-pyridinyl)-3-oxo-2-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]propanoate |
|---|---|
| PubChem CID | 22261762 |
| Molecular Formula | C19H16F5NO4 |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | ethyl 3-(2-fluoro-4-pyridinyl)-3-oxo-2-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]propanoate |
| SMILES | CCOC(=O)C(Cc1cccc(OC(F)(F)C(F)F)c1)C(=O)c1ccnc(F)c1 |
| InChI | InChI=1S/C19H16F5NO4/c1-2-28-17(27)14(16(26)12-6-7-25-15(20)10-12)9-11-4-3-5-13(8-11)29-19(23,24)18(21)22/h3-8,10,14,18H,2,9H2,1H3 |
| InChIKey | WDKBNRKTSASHHD-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|