C18H28Cl2N2O — CID 119561279
2-(4-chlorophenyl)-2-ethyl-1-[4-(methylamino)piperidin-1-yl]butan-1-one;hydrochloride (PubChem CID 119561279) has the molecular formula C18H28Cl2N2O and a molecular weight of 359.34 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-ethyl-1-[4-(methylamino)piperidin-1-yl]butan-1-one;hydrochloride.
| Compound Name | 2-(4-chlorophenyl)-2-ethyl-1-[4-(methylamino)piperidin-1-yl]butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119561279 |
| Molecular Formula | C18H28Cl2N2O |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 2-(4-chlorophenyl)-2-ethyl-1-[4-(methylamino)piperidin-1-yl]butan-1-one;hydrochloride |
| SMILES | CCC(CC)(C(=O)N1CCC(NC)CC1)c1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C18H27ClN2O.ClH/c1-4-18(5-2,14-6-8-15(19)9-7-14)17(22)21-12-10-16(20-3)11-13-21;/h6-9,16,20H,4-5,10-13H2,1-3H3;1H |
| InChIKey | ZMEZIWOSEFAWNS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |