C20H32Cl2N2O2 — CID 119662657
1-[4-(3-aminopropoxy)piperidin-1-yl]-2-(4-chlorophenyl)-2-ethylbutan-1-one;hydrochloride (PubChem CID 119662657) has the molecular formula C20H32Cl2N2O2 and a molecular weight of 403.39 g/mol. Its IUPAC name is 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-(4-chlorophenyl)-2-ethylbutan-1-one;hydrochloride.
| Compound Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-(4-chlorophenyl)-2-ethylbutan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119662657 |
| Molecular Formula | C20H32Cl2N2O2 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-(4-chlorophenyl)-2-ethylbutan-1-one;hydrochloride |
| SMILES | CCC(CC)(C(=O)N1CCC(OCCCN)CC1)c1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C20H31ClN2O2.ClH/c1-3-20(4-2,16-6-8-17(21)9-7-16)19(24)23-13-10-18(11-14-23)25-15-5-12-22;/h6-9,18H,3-5,10-15,22H2,1-2H3;1H |
| InChIKey | GMHSPBFJZFMQIS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|