C14H23N3O3S2 — CID 119594615
N-[1-[3-(1-aminoethyl)piperidin-1-yl]-1-oxopropan-2-yl]thiophene-2-sulfonamide (PubChem CID 119594615) has the molecular formula C14H23N3O3S2 and a molecular weight of 345.49 g/mol. Its IUPAC name is N-[1-[3-(1-aminoethyl)piperidin-1-yl]-1-oxopropan-2-yl]thiophene-2-sulfonamide.
| Compound Name | N-[1-[3-(1-aminoethyl)piperidin-1-yl]-1-oxopropan-2-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 119594615 |
| Molecular Formula | C14H23N3O3S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | N-[1-[3-(1-aminoethyl)piperidin-1-yl]-1-oxopropan-2-yl]thiophene-2-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1cccs1)C(=O)N1CCCC(C(C)N)C1 |
| InChI | InChI=1S/C14H23N3O3S2/c1-10(15)12-5-3-7-17(9-12)14(18)11(2)16-22(19,20)13-6-4-8-21-13/h4,6,8,10-12,16H,3,5,7,9,15H2,1-2H3 |
| InChIKey | BMXSAZUJTPSYBF-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |