C10H18N2O3 — CID 11960458
[2-(methylamino)-2-oxoethyl] N-[(E)-hex-2-enyl]carbamate (PubChem CID 11960458) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] N-[(E)-hex-2-enyl]carbamate.
| Compound Name | [2-(methylamino)-2-oxoethyl] N-[(E)-hex-2-enyl]carbamate |
|---|---|
| PubChem CID | 11960458 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl] N-[(E)-hex-2-enyl]carbamate |
| SMILES | CCC/C=C/CNC(=O)OCC(=O)NC |
| InChI | InChI=1S/C10H18N2O3/c1-3-4-5-6-7-12-10(14)15-8-9(13)11-2/h5-6H,3-4,7-8H2,1-2H3,(H,11,13)(H,12,14)/b6-5+ |
| InChIKey | IYTRQFUVPVAPSD-AATRIKPKSA-N |
| XLogP | 0.81 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|