C22H36N2O3 — CID 90894811
(2-amino-2-oxoethyl) N-nonadeca-4,7,10,13-tetraenylcarbamate (PubChem CID 90894811) has the molecular formula C22H36N2O3 and a molecular weight of 376.54 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) N-nonadeca-4,7,10,13-tetraenylcarbamate.
| Compound Name | (2-amino-2-oxoethyl) N-nonadeca-4,7,10,13-tetraenylcarbamate |
|---|---|
| PubChem CID | 90894811 |
| Molecular Formula | C22H36N2O3 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | (2-amino-2-oxoethyl) N-nonadeca-4,7,10,13-tetraenylcarbamate |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCNC(=O)OCC(N)=O |
| InChI | InChI=1S/C22H36N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24-22(26)27-20-21(23)25/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-20H2,1H3,(H2,23,25)(H,24,26) |
| InChIKey | RRKPDEHBRIZCIK-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|