C18H34N2O3 — CID 90853426
[2-(methylamino)-2-oxoethyl] N-tetradec-11-enylcarbamate (PubChem CID 90853426) has the molecular formula C18H34N2O3 and a molecular weight of 326.48 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] N-tetradec-11-enylcarbamate.
| Compound Name | [2-(methylamino)-2-oxoethyl] N-tetradec-11-enylcarbamate |
|---|---|
| PubChem CID | 90853426 |
| Molecular Formula | C18H34N2O3 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl] N-tetradec-11-enylcarbamate |
| SMILES | CCC=CCCCCCCCCCCNC(=O)OCC(=O)NC |
| InChI | InChI=1S/C18H34N2O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-20-18(22)23-16-17(21)19-2/h4-5H,3,6-16H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | PCMAVENQTQQQAR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|