C20H38N2O3 — CID 90912577
[2-(methylamino)-2-oxoethyl] N-hexadec-9-enylcarbamate (PubChem CID 90912577) has the molecular formula C20H38N2O3 and a molecular weight of 354.54 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] N-hexadec-9-enylcarbamate.
| Compound Name | [2-(methylamino)-2-oxoethyl] N-hexadec-9-enylcarbamate |
|---|---|
| PubChem CID | 90912577 |
| Molecular Formula | C20H38N2O3 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.29 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl] N-hexadec-9-enylcarbamate |
| SMILES | CCCCCCC=CCCCCCCCCNC(=O)OCC(=O)NC |
| InChI | InChI=1S/C20H38N2O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-20(24)25-18-19(23)21-2/h8-9H,3-7,10-18H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | NUELLTHDGZSBHW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|