C19H32N4O4 — CID 11960551
N,N'-bis[2-(dimethylamino)ethyl]-2-[(4-hydroxy-3-methoxyphenyl)methyl]propanediamide (PubChem CID 11960551) has the molecular formula C19H32N4O4 and a molecular weight of 380.49 g/mol. Its IUPAC name is N,N'-bis[2-(dimethylamino)ethyl]-2-[(4-hydroxy-3-methoxyphenyl)methyl]propanediamide.
| Compound Name | N,N'-bis[2-(dimethylamino)ethyl]-2-[(4-hydroxy-3-methoxyphenyl)methyl]propanediamide |
|---|---|
| PubChem CID | 11960551 |
| Molecular Formula | C19H32N4O4 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | N,N'-bis[2-(dimethylamino)ethyl]-2-[(4-hydroxy-3-methoxyphenyl)methyl]propanediamide |
| SMILES | COc1cc(CC(C(=O)NCCN(C)C)C(=O)NCCN(C)C)ccc1O |
| InChI | InChI=1S/C19H32N4O4/c1-22(2)10-8-20-18(25)15(19(26)21-9-11-23(3)4)12-14-6-7-16(24)17(13-14)27-5/h6-7,13,15,24H,8-12H2,1-5H3,(H,20,25)(H,21,26) |
| InChIKey | HIVRMQGWZYPLAY-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|