C18H21ClN2O5S — CID 119618647
N-(6-amino-1,3-benzodioxol-5-yl)-3-(3,4-dimethoxyphenyl)sulfanylpropanamide;hydrochloride (PubChem CID 119618647) has the molecular formula C18H21ClN2O5S and a molecular weight of 412.90 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-3-(3,4-dimethoxyphenyl)sulfanylpropanamide;hydrochloride.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-3-(3,4-dimethoxyphenyl)sulfanylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119618647 |
| Molecular Formula | C18H21ClN2O5S |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-3-(3,4-dimethoxyphenyl)sulfanylpropanamide;hydrochloride |
| SMILES | COc1ccc(SCCC(=O)Nc2cc3c(cc2N)OCO3)cc1OC.Cl |
| InChI | InChI=1S/C18H20N2O5S.ClH/c1-22-14-4-3-11(7-15(14)23-2)26-6-5-18(21)20-13-9-17-16(8-12(13)19)24-10-25-17;/h3-4,7-9H,5-6,10,19H2,1-2H3,(H,20,21);1H |
| InChIKey | CJGQPOUXNXDPDL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|