About 1-[1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-1-oxobutan-2-yl]pyrrolidin-2-one;hydrochloride
1-[1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-1-oxobutan-2-yl]pyrrolidin-2-one;hydrochloride (PubChem CID 119636602) has the molecular formula C15H26ClN3O2
and a molecular weight of 315.85 g/mol. Its IUPAC name is 1-[1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-1-oxobutan-2-yl]pyrrolidin-2-one;hydrochloride.
Molecular Properties
| Compound Name | 1-[1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-1-oxobutan-2-yl]pyrrolidin-2-one;hydrochloride |
| PubChem CID | 119636602 |
| Molecular Formula | C15H26ClN3O2 |
| Molecular Weight | 315.85 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 1-[1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-1-oxobutan-2-yl]pyrrolidin-2-one;hydrochloride |
| SMILES | CCC(C(=O)N1CCC2CCC(C1)N2)N1CCCC1=O.Cl |
| InChI | InChI=1S/C15H25N3O2.ClH/c1-2-13(18-8-3-4-14(18)19)15(20)17-9-7-11-5-6-12(10-17)16-11;/h11-13,16H,2-10H2,1H3;1H |
| InChIKey | RCPUASMLNCNKFR-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.85 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-1-oxobutan-2-yl]pyrrolidin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-1-oxobutan-2-yl]pyrrolidin-2-one;hydrochloride?
The IUPAC name of 1-[1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-1-oxobutan-2-yl]pyrrolidin-2-one;hydrochloride (CID 119636602) is 1-[1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-1-oxobutan-2-yl]pyrrolidin-2-one;hydrochloride.
What is the SMILES notation for 1-[1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-1-oxobutan-2-yl]pyrrolidin-2-one;hydrochloride?
The canonical SMILES for 1-[1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-1-oxobutan-2-yl]pyrrolidin-2-one;hydrochloride is CCC(C(=O)N1CCC2CCC(C1)N2)N1CCCC1=O.Cl.
What is the InChIKey of 1-[1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-1-oxobutan-2-yl]pyrrolidin-2-one;hydrochloride?
The InChIKey is RCPUASMLNCNKFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3O2.ClH/c1-2-13(18-8-3-4-14(18)19)15(20)17-9-7-11-5-6-12(10-17)16-11;/h11-13,16H,2-10H2,1H3;1H.
What are the key properties of 1-[1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-1-oxobutan-2-yl]pyrrolidin-2-one;hydrochloride?
1-[1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-1-oxobutan-2-yl]pyrrolidin-2-one;hydrochloride has a molecular weight of 315.85 g/mol, XLogP of 1.16, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(3,9-diazabicyclo[4.2.1]nonan-3-yl)-1-oxobutan-2-yl]pyrrolidin-2-one;hydrochloride is sourced from PubChem (CID 119636602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).