C18H31N3O4S — CID 127802994
N-cyclopentyl-1-[2-(2-oxopyrrolidin-1-yl)butanoyl]piperidine-3-sulfonamide (PubChem CID 127802994) has the molecular formula C18H31N3O4S and a molecular weight of 385.53 g/mol. Its IUPAC name is N-cyclopentyl-1-[2-(2-oxopyrrolidin-1-yl)butanoyl]piperidine-3-sulfonamide.
| Compound Name | N-cyclopentyl-1-[2-(2-oxopyrrolidin-1-yl)butanoyl]piperidine-3-sulfonamide |
|---|---|
| PubChem CID | 127802994 |
| Molecular Formula | C18H31N3O4S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | N-cyclopentyl-1-[2-(2-oxopyrrolidin-1-yl)butanoyl]piperidine-3-sulfonamide |
| SMILES | CCC(C(=O)N1CCCC(S(=O)(=O)NC2CCCC2)C1)N1CCCC1=O |
| InChI | InChI=1S/C18H31N3O4S/c1-2-16(21-12-6-10-17(21)22)18(23)20-11-5-9-15(13-20)26(24,25)19-14-7-3-4-8-14/h14-16,19H,2-13H2,1H3 |
| InChIKey | CXOHOSUTOYAPLY-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |