C14H24Cl2N4O2 — CID 119641344
N-[2-[(2-amino-2-ethylbutyl)amino]-2-oxoethyl]pyridine-2-carboxamide;dihydrochloride (PubChem CID 119641344) has the molecular formula C14H24Cl2N4O2 and a molecular weight of 351.28 g/mol. Its IUPAC name is N-[2-[(2-amino-2-ethylbutyl)amino]-2-oxoethyl]pyridine-2-carboxamide;dihydrochloride.
| Compound Name | N-[2-[(2-amino-2-ethylbutyl)amino]-2-oxoethyl]pyridine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119641344 |
| Molecular Formula | C14H24Cl2N4O2 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | N-[2-[(2-amino-2-ethylbutyl)amino]-2-oxoethyl]pyridine-2-carboxamide;dihydrochloride |
| SMILES | CCC(N)(CC)CNC(=O)CNC(=O)c1ccccn1.Cl.Cl |
| InChI | InChI=1S/C14H22N4O2.2ClH/c1-3-14(15,4-2)10-18-12(19)9-17-13(20)11-7-5-6-8-16-11;;/h5-8H,3-4,9-10,15H2,1-2H3,(H,17,20)(H,18,19);2*1H |
| InChIKey | ZHLOREHISUMRCY-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |