C12H12N2O3S — CID 66951625
2-(pyridine-2-carbonylamino)acetic acid;thiophene (PubChem CID 66951625) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is 2-(pyridine-2-carbonylamino)acetic acid;thiophene.
| Compound Name | 2-(pyridine-2-carbonylamino)acetic acid;thiophene |
|---|---|
| PubChem CID | 66951625 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 2-(pyridine-2-carbonylamino)acetic acid;thiophene |
| SMILES | O=C(O)CNC(=O)c1ccccn1.c1ccsc1 |
| InChI | InChI=1S/C8H8N2O3.C4H4S/c11-7(12)5-10-8(13)6-3-1-2-4-9-6;1-2-4-5-3-1/h1-4H,5H2,(H,10,13)(H,11,12);1-4H |
| InChIKey | PPXIENBNLLPJBS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |