C22H27N3O3 — CID 119645188
1-[[2-[4-(ethylaminomethyl)piperidine-1-carbonyl]furan-3-yl]methyl]-3H-indol-2-one (PubChem CID 119645188) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 1-[[2-[4-(ethylaminomethyl)piperidine-1-carbonyl]furan-3-yl]methyl]-3H-indol-2-one.
| Compound Name | 1-[[2-[4-(ethylaminomethyl)piperidine-1-carbonyl]furan-3-yl]methyl]-3H-indol-2-one |
|---|---|
| PubChem CID | 119645188 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 1-[[2-[4-(ethylaminomethyl)piperidine-1-carbonyl]furan-3-yl]methyl]-3H-indol-2-one |
| SMILES | CCNCC1CCN(C(=O)c2occc2CN2C(=O)Cc3ccccc32)CC1 |
| InChI | InChI=1S/C22H27N3O3/c1-2-23-14-16-7-10-24(11-8-16)22(27)21-18(9-12-28-21)15-25-19-6-4-3-5-17(19)13-20(25)26/h3-6,9,12,16,23H,2,7-8,10-11,13-15H2,1H3 |
| InChIKey | ARDHFOSACZLIOI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |