C19H28ClN3O3 — CID 119650186
6-[4-[2-(methylaminomethyl)pyrrolidin-1-yl]-4-oxobutoxy]-3,4-dihydro-1H-quinolin-2-one;hydrochloride (PubChem CID 119650186) has the molecular formula C19H28ClN3O3 and a molecular weight of 381.90 g/mol. Its IUPAC name is 6-[4-[2-(methylaminomethyl)pyrrolidin-1-yl]-4-oxobutoxy]-3,4-dihydro-1H-quinolin-2-one;hydrochloride.
| Compound Name | 6-[4-[2-(methylaminomethyl)pyrrolidin-1-yl]-4-oxobutoxy]-3,4-dihydro-1H-quinolin-2-one;hydrochloride |
|---|---|
| PubChem CID | 119650186 |
| Molecular Formula | C19H28ClN3O3 |
| Molecular Weight | 381.90 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 6-[4-[2-(methylaminomethyl)pyrrolidin-1-yl]-4-oxobutoxy]-3,4-dihydro-1H-quinolin-2-one;hydrochloride |
| SMILES | CNCC1CCCN1C(=O)CCCOc1ccc2c(c1)CCC(=O)N2.Cl |
| InChI | InChI=1S/C19H27N3O3.ClH/c1-20-13-15-4-2-10-22(15)19(24)5-3-11-25-16-7-8-17-14(12-16)6-9-18(23)21-17;/h7-8,12,15,20H,2-6,9-11,13H2,1H3,(H,21,23);1H |
| InChIKey | HWISFIRTQGYCGS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.90 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|