C61H112N6O11 — CID 11965609
2-[11-[2-[6-[2,3-bis[[(E)-hexadec-9-enoyl]oxy]propyl-methylamino]hexyl-methylamino]-2-oxoethyl]-4,8-bis(carboxymethyl)-1,4,8,11-tetrazacyclotetradec-1-yl]acetic acid (PubChem CID 11965609) has the molecular formula C61H112N6O11 and a molecular weight of 1105.60 g/mol. Its IUPAC name is 2-[11-[2-[6-[2,3-bis[[(E)-hexadec-9-enoyl]oxy]propyl-methylamino]hexyl-methylamino]-2-oxoethyl]-4,8-bis(carboxymethyl)-1,4,8,11-tetrazacyclotetradec-1-yl]acetic acid.
| Compound Name | 2-[11-[2-[6-[2,3-bis[[(E)-hexadec-9-enoyl]oxy]propyl-methylamino]hexyl-methylamino]-2-oxoethyl]-4,8-bis(carboxymethyl)-1,4,8,11-tetrazacyclotetradec-1-yl]acetic acid |
|---|---|
| PubChem CID | 11965609 |
| Molecular Formula | C61H112N6O11 |
| Molecular Weight | 1105.60 g/mol |
| Exact Mass | 1104.84 |
| IUPAC Name | 2-[11-[2-[6-[2,3-bis[[(E)-hexadec-9-enoyl]oxy]propyl-methylamino]hexyl-methylamino]-2-oxoethyl]-4,8-bis(carboxymethyl)-1,4,8,11-tetrazacyclotetradec-1-yl]acetic acid |
| SMILES | CCCCCC/C=C/CCCCCCCC(=O)OCC(CN(C)CCCCCCN(C)C(=O)CN1CCCN(CC(=O)O)CCN(CC(=O)O)CCCN(CC(=O)O)CC1)OC(=O)CCCCCCC/C=C/CCCCCC |
| InChI | InChI=1S/C61H112N6O11/c1-5-7-9-11-13-15-17-19-21-23-25-27-31-37-60(75)77-54-55(78-61(76)38-32-28-26-24-22-20-18-16-14-12-10-8-6-2)49-62(3)39-33-29-30-34-40-63(4)56(68)50-64-41-35-42-66(52-58(71)72)47-48-67(53-59(73)74)44-36-43-65(46-45-64)51-57(69)70/h15-18,55H,5-14,19-54H2,1-4H3,(H,69,70)(H,71,72)(H,73,74)/b17-15+,18-16+ |
| InChIKey | TWUOGQUNHKTSMJ-YTEMWHBBSA-N |
| XLogP | 10.16 |
| TPSA | 201.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1105.60 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|