C19H31N3OS — CID 119660216
N-(3-amino-4-methylpentyl)-N-methyl-2-phenyl-2-thiomorpholin-4-ylacetamide (PubChem CID 119660216) has the molecular formula C19H31N3OS and a molecular weight of 349.54 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-N-methyl-2-phenyl-2-thiomorpholin-4-ylacetamide.
| Compound Name | N-(3-amino-4-methylpentyl)-N-methyl-2-phenyl-2-thiomorpholin-4-ylacetamide |
|---|---|
| PubChem CID | 119660216 |
| Molecular Formula | C19H31N3OS |
| Molecular Weight | 349.54 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-N-methyl-2-phenyl-2-thiomorpholin-4-ylacetamide |
| SMILES | CC(C)C(N)CCN(C)C(=O)C(c1ccccc1)N1CCSCC1 |
| InChI | InChI=1S/C19H31N3OS/c1-15(2)17(20)9-10-21(3)19(23)18(16-7-5-4-6-8-16)22-11-13-24-14-12-22/h4-8,15,17-18H,9-14,20H2,1-3H3 |
| InChIKey | DFBOHVOAOSJZPG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.54 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |