C17H23Cl2FN4O2 — CID 119662738
[4-(3-aminopropoxy)piperidin-1-yl]-(7-fluoroquinoxalin-5-yl)methanone;dihydrochloride (PubChem CID 119662738) has the molecular formula C17H23Cl2FN4O2 and a molecular weight of 405.30 g/mol. Its IUPAC name is [4-(3-aminopropoxy)piperidin-1-yl]-(7-fluoroquinoxalin-5-yl)methanone;dihydrochloride.
| Compound Name | [4-(3-aminopropoxy)piperidin-1-yl]-(7-fluoroquinoxalin-5-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119662738 |
| Molecular Formula | C17H23Cl2FN4O2 |
| Molecular Weight | 405.30 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | [4-(3-aminopropoxy)piperidin-1-yl]-(7-fluoroquinoxalin-5-yl)methanone;dihydrochloride |
| SMILES | Cl.Cl.NCCCOC1CCN(C(=O)c2cc(F)cc3nccnc23)CC1 |
| InChI | InChI=1S/C17H21FN4O2.2ClH/c18-12-10-14(16-15(11-12)20-5-6-21-16)17(23)22-7-2-13(3-8-22)24-9-1-4-19;;/h5-6,10-11,13H,1-4,7-9,19H2;2*1H |
| InChIKey | WKOBIPSSXGAMQY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|