C17H33ClN4O3 — CID 119664203
1-[2-[4-(3-aminopropoxy)piperidin-1-yl]-2-oxoethyl]-3-cyclohexylurea;hydrochloride (PubChem CID 119664203) has the molecular formula C17H33ClN4O3 and a molecular weight of 376.93 g/mol. Its IUPAC name is 1-[2-[4-(3-aminopropoxy)piperidin-1-yl]-2-oxoethyl]-3-cyclohexylurea;hydrochloride.
| Compound Name | 1-[2-[4-(3-aminopropoxy)piperidin-1-yl]-2-oxoethyl]-3-cyclohexylurea;hydrochloride |
|---|---|
| PubChem CID | 119664203 |
| Molecular Formula | C17H33ClN4O3 |
| Molecular Weight | 376.93 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 1-[2-[4-(3-aminopropoxy)piperidin-1-yl]-2-oxoethyl]-3-cyclohexylurea;hydrochloride |
| SMILES | Cl.NCCCOC1CCN(C(=O)CNC(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C17H32N4O3.ClH/c18-9-4-12-24-15-7-10-21(11-8-15)16(22)13-19-17(23)20-14-5-2-1-3-6-14;/h14-15H,1-13,18H2,(H2,19,20,23);1H |
| InChIKey | KQNCINRPKALPCL-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.93 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|