C35H39NO14 — CID 11969656
diethyl 2-[[[6-[[(3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]amino]methylidene]propanedioate (PubChem CID 11969656) has the molecular formula C35H39NO14 and a molecular weight of 697.69 g/mol. Its IUPAC name is diethyl 2-[[[6-[[(3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]amino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[[6-[[(3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]amino]methylidene]propanedioate |
|---|---|
| PubChem CID | 11969656 |
| Molecular Formula | C35H39NO14 |
| Molecular Weight | 697.69 g/mol |
| Exact Mass | 697.24 |
| IUPAC Name | diethyl 2-[[[6-[[(3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]amino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNC1CC(OC2C[C@](O)(C(C)=O)Cc3c(O)c4c(c(O)c32)C(=O)c2c(OC)cccc2C4=O)OC(C)C1O)C(=O)OCC |
| InChI | InChI=1S/C35H39NO14/c1-6-47-33(43)19(34(44)48-7-2)14-36-20-11-23(49-15(3)28(20)38)50-22-13-35(45,16(4)37)12-18-25(22)32(42)27-26(30(18)40)29(39)17-9-8-10-21(46-5)24(17)31(27)41/h8-10,14-15,20,22-23,28,36,38,40,42,45H,6-7,11-13H2,1-5H3/t15?,20?,22?,23?,28?,35-/m0/s1 |
| InChIKey | ZUUCOTBVHLJZEF-LYWCKNTHSA-N |
| XLogP | 1.67 |
| TPSA | 224.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.69 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|