C18H24ClN5OS — CID 119707327
N-(3-chloro-2-propan-2-ylsulfanylphenyl)-5-methyl-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119707327) has the molecular formula C18H24ClN5OS and a molecular weight of 393.94 g/mol. Its IUPAC name is N-(3-chloro-2-propan-2-ylsulfanylphenyl)-5-methyl-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-(3-chloro-2-propan-2-ylsulfanylphenyl)-5-methyl-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119707327 |
| Molecular Formula | C18H24ClN5OS |
| Molecular Weight | 393.94 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | N-(3-chloro-2-propan-2-ylsulfanylphenyl)-5-methyl-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cccc(Cl)c2SC(C)C)nnn1C1CCNCC1 |
| InChI | InChI=1S/C18H24ClN5OS/c1-11(2)26-17-14(19)5-4-6-15(17)21-18(25)16-12(3)24(23-22-16)13-7-9-20-10-8-13/h4-6,11,13,20H,7-10H2,1-3H3,(H,21,25) |
| InChIKey | AEIGYZSRVCJNBM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.94 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |