C23H15Cl3O6 — CID 11970743
5-[(3-carboxy-5-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)-(2,3,4-trichlorophenyl)methyl]-2-hydroxy-3-methylbenzoic acid (PubChem CID 11970743) has the molecular formula C23H15Cl3O6 and a molecular weight of 493.73 g/mol. Its IUPAC name is 5-[(3-carboxy-5-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)-(2,3,4-trichlorophenyl)methyl]-2-hydroxy-3-methylbenzoic acid.
| Compound Name | 5-[(3-carboxy-5-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)-(2,3,4-trichlorophenyl)methyl]-2-hydroxy-3-methylbenzoic acid |
|---|---|
| PubChem CID | 11970743 |
| Molecular Formula | C23H15Cl3O6 |
| Molecular Weight | 493.73 g/mol |
| Exact Mass | 491.99 |
| IUPAC Name | 5-[(3-carboxy-5-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)-(2,3,4-trichlorophenyl)methyl]-2-hydroxy-3-methylbenzoic acid |
| SMILES | CC1=CC(=C(c2cc(C)c(O)c(C(=O)O)c2)c2ccc(Cl)c(Cl)c2Cl)C=C(C(=O)O)C1=O |
| InChI | InChI=1S/C23H15Cl3O6/c1-9-5-11(7-14(20(9)27)22(29)30)17(13-3-4-16(24)19(26)18(13)25)12-6-10(2)21(28)15(8-12)23(31)32/h3-8,27H,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | KDOYGFXXTQWWGR-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.73 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|