C8H17N3O3 — CID 11971069
1,3-bis(hydroxymethyl)-5-propyl-1,3,5-triazinan-2-one (PubChem CID 11971069) has the molecular formula C8H17N3O3 and a molecular weight of 203.24 g/mol. Its IUPAC name is 1,3-bis(hydroxymethyl)-5-propyl-1,3,5-triazinan-2-one.
| Compound Name | 1,3-bis(hydroxymethyl)-5-propyl-1,3,5-triazinan-2-one |
|---|---|
| PubChem CID | 11971069 |
| Molecular Formula | C8H17N3O3 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 1,3-bis(hydroxymethyl)-5-propyl-1,3,5-triazinan-2-one |
| SMILES | CCCN1CN(CO)C(=O)N(CO)C1 |
| InChI | InChI=1S/C8H17N3O3/c1-2-3-9-4-10(6-12)8(14)11(5-9)7-13/h12-13H,2-7H2,1H3 |
| InChIKey | OKTQWTOTDZMNHS-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 67.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |