C9H20N3O3+ — CID 69402270
5-butyl-1,1-bis(hydroxymethyl)-1,3,5-triazinan-1-ium-2-one (PubChem CID 69402270) has the molecular formula C9H20N3O3+ and a molecular weight of 218.28 g/mol. Its IUPAC name is 5-butyl-1,1-bis(hydroxymethyl)-1,3,5-triazinan-1-ium-2-one.
| Compound Name | 5-butyl-1,1-bis(hydroxymethyl)-1,3,5-triazinan-1-ium-2-one |
|---|---|
| PubChem CID | 69402270 |
| Molecular Formula | C9H20N3O3+ |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 5-butyl-1,1-bis(hydroxymethyl)-1,3,5-triazinan-1-ium-2-one |
| SMILES | CCCCN1CNC(=O)[N+](CO)(CO)C1 |
| InChI | InChI=1S/C9H19N3O3/c1-2-3-4-11-5-10-9(15)12(6-11,7-13)8-14/h13-14H,2-8H2,1H3/p+1 |
| InChIKey | OEBSBQRAGUJFJC-UHFFFAOYSA-O |
| XLogP | -0.56 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|