C21H24O2 — CID 11974794
(2S)-2-cyclohexyl-2-phenyl-2-phenylmethoxyacetaldehyde (PubChem CID 11974794) has the molecular formula C21H24O2 and a molecular weight of 308.42 g/mol. Its IUPAC name is (2S)-2-cyclohexyl-2-phenyl-2-phenylmethoxyacetaldehyde.
| Compound Name | (2S)-2-cyclohexyl-2-phenyl-2-phenylmethoxyacetaldehyde |
|---|---|
| PubChem CID | 11974794 |
| Molecular Formula | C21H24O2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | (2S)-2-cyclohexyl-2-phenyl-2-phenylmethoxyacetaldehyde |
| SMILES | O=C[C@@](OCc1ccccc1)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C21H24O2/c22-17-21(19-12-6-2-7-13-19,20-14-8-3-9-15-20)23-16-18-10-4-1-5-11-18/h1-2,4-7,10-13,17,20H,3,8-9,14-16H2/t21-/m1/s1 |
| InChIKey | OYCKWIYFUBUJBX-OAQYLSRUSA-N |
| XLogP | 4.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|