C16H13F3O2 — CID 101004595
(2S)-3,3,3-trifluoro-2-phenyl-2-phenylmethoxypropanal (PubChem CID 101004595) has the molecular formula C16H13F3O2 and a molecular weight of 294.27 g/mol. Its IUPAC name is (2S)-3,3,3-trifluoro-2-phenyl-2-phenylmethoxypropanal.
| Compound Name | (2S)-3,3,3-trifluoro-2-phenyl-2-phenylmethoxypropanal |
|---|---|
| PubChem CID | 101004595 |
| Molecular Formula | C16H13F3O2 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | (2S)-3,3,3-trifluoro-2-phenyl-2-phenylmethoxypropanal |
| SMILES | O=C[C@@](OCc1ccccc1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H13F3O2/c17-16(18,19)15(12-20,14-9-5-2-6-10-14)21-11-13-7-3-1-4-8-13/h1-10,12H,11H2/t15-/m1/s1 |
| InChIKey | NYAWIELFLOTMPK-OAHLLOKOSA-N |
| XLogP | 3.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|