C19H20F2O6 — CID 88507865
(3R,4S)-3,5-bis(benzylperoxy)-2,2-difluoro-4-hydroxypentanal (PubChem CID 88507865) has the molecular formula C19H20F2O6 and a molecular weight of 382.36 g/mol. Its IUPAC name is (3R,4S)-3,5-bis(benzylperoxy)-2,2-difluoro-4-hydroxypentanal.
| Compound Name | (3R,4S)-3,5-bis(benzylperoxy)-2,2-difluoro-4-hydroxypentanal |
|---|---|
| PubChem CID | 88507865 |
| Molecular Formula | C19H20F2O6 |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | (3R,4S)-3,5-bis(benzylperoxy)-2,2-difluoro-4-hydroxypentanal |
| SMILES | O=CC(F)(F)[C@H](OOCc1ccccc1)[C@@H](O)COOCc1ccccc1 |
| InChI | InChI=1S/C19H20F2O6/c20-19(21,14-22)18(27-26-12-16-9-5-2-6-10-16)17(23)13-25-24-11-15-7-3-1-4-8-15/h1-10,14,17-18,23H,11-13H2/t17-,18+/m0/s1 |
| InChIKey | DQEFUYIOSJYBLN-ZWKOTPCHSA-N |
| XLogP | 2.85 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|