C37H44F2O6Si2 — CID 88507725
(3R,4S)-3,5-bis[[tert-butyl(diphenyl)silyl]peroxy]-2,2-difluoro-4-hydroxypentanal (PubChem CID 88507725) has the molecular formula C37H44F2O6Si2 and a molecular weight of 678.92 g/mol. Its IUPAC name is (3R,4S)-3,5-bis[[tert-butyl(diphenyl)silyl]peroxy]-2,2-difluoro-4-hydroxypentanal.
| Compound Name | (3R,4S)-3,5-bis[[tert-butyl(diphenyl)silyl]peroxy]-2,2-difluoro-4-hydroxypentanal |
|---|---|
| PubChem CID | 88507725 |
| Molecular Formula | C37H44F2O6Si2 |
| Molecular Weight | 678.92 g/mol |
| Exact Mass | 678.26 |
| IUPAC Name | (3R,4S)-3,5-bis[[tert-butyl(diphenyl)silyl]peroxy]-2,2-difluoro-4-hydroxypentanal |
| SMILES | CC(C)(C)[Si](OOC[C@H](O)[C@@H](OO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(F)(F)C=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H44F2O6Si2/c1-35(2,3)46(29-19-11-7-12-20-29,30-21-13-8-14-22-30)44-42-27-33(41)34(37(38,39)28-40)43-45-47(36(4,5)6,31-23-15-9-16-24-31)32-25-17-10-18-26-32/h7-26,28,33-34,41H,27H2,1-6H3/t33-,34+/m0/s1 |
| InChIKey | BTHLOUFNACSRMQ-SZAHLOSFSA-N |
| XLogP | 5.57 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.92 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|