C17H27NO2Si — CID 154299369
N-(2-cyclohexyl-2-phenyl-2-trimethylsilyloxyethylidene)hydroxylamine (PubChem CID 154299369) has the molecular formula C17H27NO2Si and a molecular weight of 305.49 g/mol. Its IUPAC name is N-(2-cyclohexyl-2-phenyl-2-trimethylsilyloxyethylidene)hydroxylamine.
| Compound Name | N-(2-cyclohexyl-2-phenyl-2-trimethylsilyloxyethylidene)hydroxylamine |
|---|---|
| PubChem CID | 154299369 |
| Molecular Formula | C17H27NO2Si |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | N-(2-cyclohexyl-2-phenyl-2-trimethylsilyloxyethylidene)hydroxylamine |
| SMILES | C[Si](C)(C)OC(C=NO)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C17H27NO2Si/c1-21(2,3)20-17(14-18-19,15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4,6-7,10-11,14,16,19H,5,8-9,12-13H2,1-3H3 |
| InChIKey | CDJOGCHRRNLNII-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|