C21H30O2Si — CID 15105840
1-cyclohexyl-1-phenyl-1-trimethylsilyloxyhex-5-yn-2-one (PubChem CID 15105840) has the molecular formula C21H30O2Si and a molecular weight of 342.56 g/mol. Its IUPAC name is 1-cyclohexyl-1-phenyl-1-trimethylsilyloxyhex-5-yn-2-one.
| Compound Name | 1-cyclohexyl-1-phenyl-1-trimethylsilyloxyhex-5-yn-2-one |
|---|---|
| PubChem CID | 15105840 |
| Molecular Formula | C21H30O2Si |
| Molecular Weight | 342.56 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | 1-cyclohexyl-1-phenyl-1-trimethylsilyloxyhex-5-yn-2-one |
| SMILES | C#CCCC(=O)C(O[Si](C)(C)C)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C21H30O2Si/c1-5-6-17-20(22)21(23-24(2,3)4,18-13-9-7-10-14-18)19-15-11-8-12-16-19/h1,7,9-10,13-14,19H,6,8,11-12,15-17H2,2-4H3 |
| InChIKey | OYWFTQAMDSVGDV-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.56 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|