C18H21O2Si — CID 19817233
CID 19817233 (PubChem CID 19817233) has the molecular formula C18H21O2Si and a molecular weight of 297.45 g/mol.
| Compound Name | CID 19817233 |
|---|---|
| PubChem CID | 19817233 |
| Molecular Formula | C18H21O2Si |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | — |
| SMILES | C#CCCC(=O)C(O[Si])(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C18H21O2Si/c1-2-3-14-17(19)18(20-21,15-10-6-4-7-11-15)16-12-8-5-9-13-16/h1,4,6-7,10-11,16H,3,5,8-9,12-14H2 |
| InChIKey | VTPLBQWGSWBYNQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|