About CID 19817233
CID 19817233 (PubChem CID 19817233) has the molecular formula C18H21O2Si
and a molecular weight of 297.45 g/mol.
Molecular Properties
| Compound Name | CID 19817233 |
| PubChem CID | 19817233 |
| Molecular Formula | C18H21O2Si |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | — |
| SMILES | C#CCCC(=O)C(O[Si])(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C18H21O2Si/c1-2-3-14-17(19)18(20-21,15-10-6-4-7-11-15)16-12-8-5-9-13-16/h1,4,6-7,10-11,16H,3,5,8-9,12-14H2 |
| InChIKey | VTPLBQWGSWBYNQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 19817233 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 19817233?
The IUPAC name of CID 19817233 (CID 19817233) is not available.
What is the SMILES notation for CID 19817233?
The canonical SMILES for CID 19817233 is C#CCCC(=O)C(O[Si])(c1ccccc1)C1CCCCC1.
What is the InChIKey of CID 19817233?
The InChIKey is VTPLBQWGSWBYNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21O2Si/c1-2-3-14-17(19)18(20-21,15-10-6-4-7-11-15)16-12-8-5-9-13-16/h1,4,6-7,10-11,16H,3,5,8-9,12-14H2.
What are the key properties of CID 19817233?
CID 19817233 has a molecular weight of 297.45 g/mol, XLogP of 3.54, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 19817233 is sourced from PubChem (CID 19817233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).