C18H28O2Si — CID 125497693
[(S)-cyclohexyl-[(2S)-oxiran-2-yl]-phenylmethoxy]-trimethylsilane (PubChem CID 125497693) has the molecular formula C18H28O2Si and a molecular weight of 304.51 g/mol. Its IUPAC name is [(S)-cyclohexyl-[(2S)-oxiran-2-yl]-phenylmethoxy]-trimethylsilane.
| Compound Name | [(S)-cyclohexyl-[(2S)-oxiran-2-yl]-phenylmethoxy]-trimethylsilane |
|---|---|
| PubChem CID | 125497693 |
| Molecular Formula | C18H28O2Si |
| Molecular Weight | 304.51 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | [(S)-cyclohexyl-[(2S)-oxiran-2-yl]-phenylmethoxy]-trimethylsilane |
| SMILES | C[Si](C)(C)O[C@](c1ccccc1)(C1CCCCC1)[C@@H]1CO1 |
| InChI | InChI=1S/C18H28O2Si/c1-21(2,3)20-18(17-14-19-17,15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4,6-7,10-11,16-17H,5,8-9,12-14H2,1-3H3/t17-,18+/m0/s1 |
| InChIKey | KLOOPMXTEQGZFQ-ZWKOTPCHSA-N |
| XLogP | 4.71 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|