C28H31NO — CID 54004777
(2S)-2-[cyclohexyl(trityl)amino]propanal (PubChem CID 54004777) has the molecular formula C28H31NO and a molecular weight of 397.56 g/mol. Its IUPAC name is (2S)-2-[cyclohexyl(trityl)amino]propanal.
| Compound Name | (2S)-2-[cyclohexyl(trityl)amino]propanal |
|---|---|
| PubChem CID | 54004777 |
| Molecular Formula | C28H31NO |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | (2S)-2-[cyclohexyl(trityl)amino]propanal |
| SMILES | C[C@@H](C=O)N(C1CCCCC1)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H31NO/c1-23(22-30)29(27-20-12-5-13-21-27)28(24-14-6-2-7-15-24,25-16-8-3-9-17-25)26-18-10-4-11-19-26/h2-4,6-11,14-19,22-23,27H,5,12-13,20-21H2,1H3/t23-/m0/s1 |
| InChIKey | KOBXJRKKYVVIBR-QHCPKHFHSA-N |
| XLogP | 6.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|