C18H26N2O5 — CID 119753825
methyl 2-[(4-ethoxyphenyl)methyl]-3-(morpholine-3-carbonylamino)propanoate (PubChem CID 119753825) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is methyl 2-[(4-ethoxyphenyl)methyl]-3-(morpholine-3-carbonylamino)propanoate.
| Compound Name | methyl 2-[(4-ethoxyphenyl)methyl]-3-(morpholine-3-carbonylamino)propanoate |
|---|---|
| PubChem CID | 119753825 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | methyl 2-[(4-ethoxyphenyl)methyl]-3-(morpholine-3-carbonylamino)propanoate |
| SMILES | CCOc1ccc(CC(CNC(=O)C2COCCN2)C(=O)OC)cc1 |
| InChI | InChI=1S/C18H26N2O5/c1-3-25-15-6-4-13(5-7-15)10-14(18(22)23-2)11-20-17(21)16-12-24-9-8-19-16/h4-7,14,16,19H,3,8-12H2,1-2H3,(H,20,21) |
| InChIKey | XXFYTIYKGOWECT-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |