C19H26ClN5O2 — CID 119762042
1-[2-(3-piperidin-3-ylbutanoylamino)phenyl]pyrazole-3-carboxamide;hydrochloride (PubChem CID 119762042) has the molecular formula C19H26ClN5O2 and a molecular weight of 391.90 g/mol. Its IUPAC name is 1-[2-(3-piperidin-3-ylbutanoylamino)phenyl]pyrazole-3-carboxamide;hydrochloride.
| Compound Name | 1-[2-(3-piperidin-3-ylbutanoylamino)phenyl]pyrazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119762042 |
| Molecular Formula | C19H26ClN5O2 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 1-[2-(3-piperidin-3-ylbutanoylamino)phenyl]pyrazole-3-carboxamide;hydrochloride |
| SMILES | CC(CC(=O)Nc1ccccc1-n1ccc(C(N)=O)n1)C1CCCNC1.Cl |
| InChI | InChI=1S/C19H25N5O2.ClH/c1-13(14-5-4-9-21-12-14)11-18(25)22-15-6-2-3-7-17(15)24-10-8-16(23-24)19(20)26;/h2-3,6-8,10,13-14,21H,4-5,9,11-12H2,1H3,(H2,20,26)(H,22,25);1H |
| InChIKey | PQBLIOYLTXDWAU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |